C24H30N8Pt — CID 140723061
bis(4-(3-tert-butylpyrazol-1-id-5-yl)-2-methylpyrimidine);platinum(2+) (PubChem CID 140723061) has the molecular formula C24H30N8Pt and a molecular weight of 625.64 g/mol. Its IUPAC name is bis(4-(3-tert-butylpyrazol-1-id-5-yl)-2-methylpyrimidine);platinum(2+).
| Compound Name | bis(4-(3-tert-butylpyrazol-1-id-5-yl)-2-methylpyrimidine);platinum(2+) |
|---|---|
| PubChem CID | 140723061 |
| Molecular Formula | C24H30N8Pt |
| Molecular Weight | 625.64 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | bis(4-(3-tert-butylpyrazol-1-id-5-yl)-2-methylpyrimidine);platinum(2+) |
| SMILES | Cc1nccc(-c2cc(C(C)(C)C)n[n-]2)n1.Cc1nccc(-c2cc(C(C)(C)C)n[n-]2)n1.[Pt+2] |
| InChI | InChI=1S/2C12H15N4.Pt/c2*1-8-13-6-5-9(14-8)10-7-11(16-15-10)12(2,3)4;/h2*5-7H,1-4H3;/q2*-1;+2 |
| InChIKey | DDKFYAGUAPBJKV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |