C24H27BN4O3 — CID 140723395
1-[4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]-3-phenylurea (PubChem CID 140723395) has the molecular formula C24H27BN4O3 and a molecular weight of 430.32 g/mol. Its IUPAC name is 1-[4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 140723395 |
| Molecular Formula | C24H27BN4O3 |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 1-[4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]-3-phenylurea |
| SMILES | CC1(C)OB(c2cnc(N)c(-c3ccc(NC(=O)Nc4ccccc4)cc3)c2)OC1(C)C |
| InChI | InChI=1S/C24H27BN4O3/c1-23(2)24(3,4)32-25(31-23)17-14-20(21(26)27-15-17)16-10-12-19(13-11-16)29-22(30)28-18-8-6-5-7-9-18/h5-15H,1-4H3,(H2,26,27)(H2,28,29,30) |
| InChIKey | MPBUNHUNYNCBLY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|