C24H15F3IrN4-2 — CID 140724057
iridium;1-phenyl-3-[3-[2-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-2H-imidazo[4,5-b]pyrazin-2-ide (PubChem CID 140724057) has the molecular formula C24H15F3IrN4-2 and a molecular weight of 608.62 g/mol. Its IUPAC name is iridium;1-phenyl-3-[3-[2-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-2H-imidazo[4,5-b]pyrazin-2-ide.
| Compound Name | iridium;1-phenyl-3-[3-[2-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-2H-imidazo[4,5-b]pyrazin-2-ide |
|---|---|
| PubChem CID | 140724057 |
| Molecular Formula | C24H15F3IrN4-2 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | iridium;1-phenyl-3-[3-[2-(trifluoromethyl)phenyl]benzene-6-id-1-yl]-2H-imidazo[4,5-b]pyrazin-2-ide |
| SMILES | FC(F)(F)c1ccccc1-c1cc[c-]c(N2[CH-]N(c3ccccc3)c3nccnc32)c1.[Ir] |
| InChI | InChI=1S/C24H15F3N4.Ir/c25-24(26,27)21-12-5-4-11-20(21)17-7-6-10-19(15-17)31-16-30(18-8-2-1-3-9-18)22-23(31)29-14-13-28-22;/h1-9,11-16H;/q-2; |
| InChIKey | OUNRSYQDNNOVSM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|