C19H21FN2O2 — CID 140725174
[(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-fluorophenyl)phenyl]-N-methylcarbamate (PubChem CID 140725174) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is [(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-fluorophenyl)phenyl]-N-methylcarbamate.
| Compound Name | [(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-fluorophenyl)phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 140725174 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-fluorophenyl)phenyl]-N-methylcarbamate |
| SMILES | CN1CC[C@@H](OC(=O)N(C)c2ccccc2-c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H21FN2O2/c1-21-11-10-16(13-21)24-19(23)22(2)18-9-4-3-8-17(18)14-6-5-7-15(20)12-14/h3-9,12,16H,10-11,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | PUZVYKRTTKQHQZ-MRXNPFEDSA-N |
| XLogP | 3.77 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |