About [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid
[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid (PubChem CID 140726663) has the molecular formula C10H13BN2O3
and a molecular weight of 220.04 g/mol. Its IUPAC name is [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid.
Molecular Properties
| Compound Name | [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid |
| PubChem CID | 140726663 |
| Molecular Formula | C10H13BN2O3 |
| Molecular Weight | 220.04 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid |
| SMILES | CC1(C)COC(c2ccc(B(O)O)cn2)=N1 |
| InChI | InChI=1S/C10H13BN2O3/c1-10(2)6-16-9(13-10)8-4-3-7(5-12-8)11(14)15/h3-5,14-15H,6H2,1-2H3 |
| InChIKey | ZERCJJPXAYISDB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.04 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid?
The IUPAC name of [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid (CID 140726663) is [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid.
What is the SMILES notation for [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid?
The canonical SMILES for [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid is CC1(C)COC(c2ccc(B(O)O)cn2)=N1.
What is the InChIKey of [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid?
The InChIKey is ZERCJJPXAYISDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BN2O3/c1-10(2)6-16-9(13-10)8-4-3-7(5-12-8)11(14)15/h3-5,14-15H,6H2,1-2H3.
What are the key properties of [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid?
[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid has a molecular weight of 220.04 g/mol, XLogP of -0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]boronic acid is sourced from PubChem (CID 140726663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).