C16H23BF2N2O2 — CID 140726673
2-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 140726673) has the molecular formula C16H23BF2N2O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 140726673 |
| Molecular Formula | C16H23BF2N2O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1OB(c2ccc(CCN3CCC(F)(F)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C16H23BF2N2O2/c1-12-15(2,3)23-17(22-12)13-4-5-14(20-10-13)6-8-21-9-7-16(18,19)11-21/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | WBYRPGUTILINHB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|