About but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane
but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane (PubChem CID 140727695) has the molecular formula C21H24OSi
and a molecular weight of 320.51 g/mol. Its IUPAC name is but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane.
Molecular Properties
| Compound Name | but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane |
| PubChem CID | 140727695 |
| Molecular Formula | C21H24OSi |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane |
| SMILES | C=CCC[Si](OC(C=C)C=C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24OSi/c1-4-7-18-23(22-19(5-2)6-3,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h4-6,8-17,19H,1-3,7,18H2 |
| InChIKey | DSLXVZMMUHLBKY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane?
The IUPAC name of but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane (CID 140727695) is but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane.
What is the SMILES notation for but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane?
The canonical SMILES for but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane is C=CCC[Si](OC(C=C)C=C)(c1ccccc1)c1ccccc1.
What is the InChIKey of but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane?
The InChIKey is DSLXVZMMUHLBKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24OSi/c1-4-7-18-23(22-19(5-2)6-3,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h4-6,8-17,19H,1-3,7,18H2.
What are the key properties of but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane?
but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane has a molecular weight of 320.51 g/mol, XLogP of 4.08, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl-penta-1,4-dien-3-yloxy-diphenylsilane is sourced from PubChem (CID 140727695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).