C48H32BN — CID 140727703
N-naphthalen-2-yl-6-[naphthalen-1-yl(phenyl)boranyl]-N-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-amine (PubChem CID 140727703) has the molecular formula C48H32BN and a molecular weight of 638.63 g/mol. Its IUPAC name is N-naphthalen-2-yl-6-[naphthalen-1-yl(phenyl)boranyl]-N-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-amine.
| Compound Name | N-naphthalen-2-yl-6-[naphthalen-1-yl(phenyl)boranyl]-N-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-amine |
|---|---|
| PubChem CID | 140727703 |
| Molecular Formula | C48H32BN |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | N-naphthalen-2-yl-6-[naphthalen-1-yl(phenyl)boranyl]-N-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc3ccccc3c2)c2ccc3ccc4c(B(c5ccccc5)c5cccc6ccccc56)ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C48H32BN/c1-3-16-38(17-4-1)49(44-21-11-15-34-13-9-10-20-41(34)44)45-30-25-35-24-29-43-46(31-26-36-23-28-42(45)47(35)48(36)43)50(39-18-5-2-6-19-39)40-27-22-33-12-7-8-14-37(33)32-40/h1-32H/i2D,5D,6D,18D,19D |
| InChIKey | SLNYZMCMNVHUDG-GTHNAFMHSA-N |
| XLogP | 10.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|