C36H34BBr — CID 140727732
(6-bromo-3,8-dimethylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140727732) has the molecular formula C36H34BBr and a molecular weight of 557.38 g/mol. Its IUPAC name is (6-bromo-3,8-dimethylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | (6-bromo-3,8-dimethylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140727732 |
| Molecular Formula | C36H34BBr |
| Molecular Weight | 557.38 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | (6-bromo-3,8-dimethylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2cc(C)c3ccc4c(Br)cc(C)c5ccc2c3c54)c(C)c1 |
| InChI | InChI=1S/C36H34BBr/c1-19-13-23(5)35(24(6)14-19)37(36-25(7)15-20(2)16-26(36)8)31-17-21(3)27-10-12-30-32(38)18-22(4)28-9-11-29(31)33(27)34(28)30/h9-18H,1-8H3 |
| InChIKey | MGMGHNUDYNOFIY-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.38 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|