C39H24N2O3S — CID 140727871
10-dibenzofuran-2-yl-3-(3-isocyanocarbazol-9-yl)-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide (PubChem CID 140727871) has the molecular formula C39H24N2O3S and a molecular weight of 600.70 g/mol. Its IUPAC name is 10-dibenzofuran-2-yl-3-(3-isocyanocarbazol-9-yl)-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide.
| Compound Name | 10-dibenzofuran-2-yl-3-(3-isocyanocarbazol-9-yl)-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide |
|---|---|
| PubChem CID | 140727871 |
| Molecular Formula | C39H24N2O3S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 10-dibenzofuran-2-yl-3-(3-isocyanocarbazol-9-yl)-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc2c(c1)CS(=O)(=O)Cc1ccc(-c3ccc4oc5ccccc5c4c3)cc1-2 |
| InChI | InChI=1S/C39H24N2O3S/c1-40-28-13-16-37-34(21-28)31-6-2-4-8-36(31)41(37)29-14-15-30-27(18-29)23-45(42,43)22-26-11-10-24(19-33(26)30)25-12-17-39-35(20-25)32-7-3-5-9-38(32)44-39/h2-21H,22-23H2 |
| InChIKey | BUZDKVGKOARINY-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|