C45H30N2S — CID 140727920
9-[3-(3,5-diphenylphenyl)-5,7-dihydrobenzo[d][2]benzothiepin-10-yl]-3-isocyanocarbazole (PubChem CID 140727920) has the molecular formula C45H30N2S and a molecular weight of 630.82 g/mol. Its IUPAC name is 9-[3-(3,5-diphenylphenyl)-5,7-dihydrobenzo[d][2]benzothiepin-10-yl]-3-isocyanocarbazole.
| Compound Name | 9-[3-(3,5-diphenylphenyl)-5,7-dihydrobenzo[d][2]benzothiepin-10-yl]-3-isocyanocarbazole |
|---|---|
| PubChem CID | 140727920 |
| Molecular Formula | C45H30N2S |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | 9-[3-(3,5-diphenylphenyl)-5,7-dihydrobenzo[d][2]benzothiepin-10-yl]-3-isocyanocarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc2c(c1)-c1ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc1CSC2 |
| InChI | InChI=1S/C45H30N2S/c1-46-38-18-21-45-43(26-38)41-14-8-9-15-44(41)47(45)39-19-16-33-28-48-29-37-22-32(17-20-40(37)42(33)27-39)36-24-34(30-10-4-2-5-11-30)23-35(25-36)31-12-6-3-7-13-31/h2-27H,28-29H2 |
| InChIKey | CCWVOSLFMOJGBD-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|