C51H37BF10N2O2 — CID 140728268
[2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(7,12-diphenylbenzo[k]fluoranthen-3-yl)methyl]-3,5-dimethylpyrrol-1-yl]-bis(2,2,3,3,3-pentafluoropropoxy)borane (PubChem CID 140728268) has the molecular formula C51H37BF10N2O2 and a molecular weight of 910.66 g/mol. Its IUPAC name is [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(7,12-diphenylbenzo[k]fluoranthen-3-yl)methyl]-3,5-dimethylpyrrol-1-yl]-bis(2,2,3,3,3-pentafluoropropoxy)borane.
| Compound Name | [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(7,12-diphenylbenzo[k]fluoranthen-3-yl)methyl]-3,5-dimethylpyrrol-1-yl]-bis(2,2,3,3,3-pentafluoropropoxy)borane |
|---|---|
| PubChem CID | 140728268 |
| Molecular Formula | C51H37BF10N2O2 |
| Molecular Weight | 910.66 g/mol |
| Exact Mass | 910.28 |
| IUPAC Name | [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(7,12-diphenylbenzo[k]fluoranthen-3-yl)methyl]-3,5-dimethylpyrrol-1-yl]-bis(2,2,3,3,3-pentafluoropropoxy)borane |
| SMILES | CC1=CC(C)=N/C1=C(/c1ccc2c3c(cccc13)-c1c-2c(-c2ccccc2)c2ccccc2c1-c1ccccc1)c1c(C)cc(C)n1B(OCC(F)(F)C(F)(F)F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C51H37BF10N2O2/c1-28-24-30(3)63-46(28)45(47-29(2)25-31(4)64(47)52(65-26-48(53,54)50(57,58)59)66-27-49(55,56)51(60,61)62)37-22-23-39-42-36(37)20-13-21-38(42)43-40(32-14-7-5-8-15-32)34-18-11-12-19-35(34)41(44(39)43)33-16-9-6-10-17-33/h5-25H,26-27H2,1-4H3/b46-45- |
| InChIKey | QFVAETOBQJQAGV-KZXRXFMCSA-N |
| XLogP | 14.83 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.66 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|