C62H61BF6N2O2 — CID 140728282
[2-[(1Z)-1-[3,5-bis(4-tert-butylphenyl)pyrrol-2-ylidene]ethyl]-3,5-bis(4-tert-butylphenyl)pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane (PubChem CID 140728282) has the molecular formula C62H61BF6N2O2 and a molecular weight of 990.98 g/mol. Its IUPAC name is [2-[(1Z)-1-[3,5-bis(4-tert-butylphenyl)pyrrol-2-ylidene]ethyl]-3,5-bis(4-tert-butylphenyl)pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane.
| Compound Name | [2-[(1Z)-1-[3,5-bis(4-tert-butylphenyl)pyrrol-2-ylidene]ethyl]-3,5-bis(4-tert-butylphenyl)pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane |
|---|---|
| PubChem CID | 140728282 |
| Molecular Formula | C62H61BF6N2O2 |
| Molecular Weight | 990.98 g/mol |
| Exact Mass | 990.47 |
| IUPAC Name | [2-[(1Z)-1-[3,5-bis(4-tert-butylphenyl)pyrrol-2-ylidene]ethyl]-3,5-bis(4-tert-butylphenyl)pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane |
| SMILES | C/C(=C1/N=C(c2ccc(C(C)(C)C)cc2)C=C1c1ccc(C(C)(C)C)cc1)c1c(-c2ccc(C(C)(C)C)cc2)cc(-c2ccc(C(C)(C)C)cc2)n1B(Oc1cc(F)c(F)c(F)c1)Oc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C62H61BF6N2O2/c1-36(57-47(37-14-22-41(23-15-37)59(2,3)4)34-53(70-57)39-18-26-43(27-19-39)61(8,9)10)58-48(38-16-24-42(25-17-38)60(5,6)7)35-54(40-20-28-44(29-21-40)62(11,12)13)71(58)63(72-45-30-49(64)55(68)50(65)31-45)73-46-32-51(66)56(69)52(67)33-46/h14-35H,1-13H3/b57-36- |
| InChIKey | UYDCBQQNJNYBRA-HPBMAANVSA-N |
| XLogP | 17.16 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.98 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|