C52H43BF6N2O2 — CID 140728310
[3,5-bis(4-tert-butylphenyl)-2-[(1Z)-1-(3-phenylisoindol-1-ylidene)ethyl]pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane (PubChem CID 140728310) has the molecular formula C52H43BF6N2O2 and a molecular weight of 852.73 g/mol. Its IUPAC name is [3,5-bis(4-tert-butylphenyl)-2-[(1Z)-1-(3-phenylisoindol-1-ylidene)ethyl]pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane.
| Compound Name | [3,5-bis(4-tert-butylphenyl)-2-[(1Z)-1-(3-phenylisoindol-1-ylidene)ethyl]pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane |
|---|---|
| PubChem CID | 140728310 |
| Molecular Formula | C52H43BF6N2O2 |
| Molecular Weight | 852.73 g/mol |
| Exact Mass | 852.33 |
| IUPAC Name | [3,5-bis(4-tert-butylphenyl)-2-[(1Z)-1-(3-phenylisoindol-1-ylidene)ethyl]pyrrol-1-yl]-bis(3,4,5-trifluorophenoxy)borane |
| SMILES | C/C(=C1/N=C(c2ccccc2)c2ccccc21)c1c(-c2ccc(C(C)(C)C)cc2)cc(-c2ccc(C(C)(C)C)cc2)n1B(Oc1cc(F)c(F)c(F)c1)Oc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C52H43BF6N2O2/c1-30(48-38-15-11-12-16-39(38)49(60-48)33-13-9-8-10-14-33)50-40(31-17-21-34(22-18-31)51(2,3)4)29-45(32-19-23-35(24-20-32)52(5,6)7)61(50)53(62-36-25-41(54)46(58)42(55)26-36)63-37-27-43(56)47(59)44(57)28-37/h8-29H,1-7H3/b48-30- |
| InChIKey | GJKVYSAVZOLLQB-UQFZDNAUSA-N |
| XLogP | 13.98 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.73 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|