About 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione
7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione (PubChem CID 140728355) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione.
Molecular Properties
| Compound Name | 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione |
| PubChem CID | 140728355 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione |
| SMILES | CCC(=O)C(O)CC(=O)C(=CCC(C)O)CC |
| InChI | InChI=1S/C13H22O4/c1-4-10(7-6-9(3)14)12(16)8-13(17)11(15)5-2/h7,9,13-14,17H,4-6,8H2,1-3H3 |
| InChIKey | VFYIEIQQAAQOCL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione?
The IUPAC name of 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione (CID 140728355) is 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione.
What is the SMILES notation for 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione?
The canonical SMILES for 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione is CCC(=O)C(O)CC(=O)C(=CCC(C)O)CC.
What is the InChIKey of 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione?
The InChIKey is VFYIEIQQAAQOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-4-10(7-6-9(3)14)12(16)8-13(17)11(15)5-2/h7,9,13-14,17H,4-6,8H2,1-3H3.
What are the key properties of 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione?
7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione has a molecular weight of 242.31 g/mol, XLogP of 1.39, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4,10-dihydroxyundec-7-ene-3,6-dione is sourced from PubChem (CID 140728355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).