C18H16N4O3 — CID 140729025
N-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrimidine-4-carboxamide (PubChem CID 140729025) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrimidine-4-carboxamide.
| Compound Name | N-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 140729025 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[3-[2-[(3R)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]pyrimidine-4-carboxamide |
| SMILES | CN1CC[C@@](O)(C#Cc2cccc(NC(=O)c3ccncn3)c2)C1=O |
| InChI | InChI=1S/C18H16N4O3/c1-22-10-8-18(25,17(22)24)7-5-13-3-2-4-14(11-13)21-16(23)15-6-9-19-12-20-15/h2-4,6,9,11-12,25H,8,10H2,1H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | ZDJCTMUTXFCHSX-SFHVURJKSA-N |
| XLogP | 0.67 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|