About 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole
1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole (PubChem CID 140731113) has the molecular formula C20H14N4O2
and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole.
Molecular Properties
| Compound Name | 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole |
| PubChem CID | 140731113 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole |
| SMILES | c1cc(Oc2cccc(-n3ncc4occc43)c2)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C20H14N4O2/c1-4-15(23-10-3-9-21-23)12-17(6-1)26-18-7-2-5-16(13-18)24-19-8-11-25-20(19)14-22-24/h1-14H |
| InChIKey | IZXCOCBQEZFSQY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole?
The IUPAC name of 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole (CID 140731113) is 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole.
What is the SMILES notation for 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole?
The canonical SMILES for 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole is c1cc(Oc2cccc(-n3ncc4occc43)c2)cc(-n2cccn2)c1.
What is the InChIKey of 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole?
The InChIKey is IZXCOCBQEZFSQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O2/c1-4-15(23-10-3-9-21-23)12-17(6-1)26-18-7-2-5-16(13-18)24-19-8-11-25-20(19)14-22-24/h1-14H.
What are the key properties of 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole?
1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole has a molecular weight of 342.36 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3-pyrazol-1-ylphenoxy)phenyl]furo[2,3-d]pyrazole is sourced from PubChem (CID 140731113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).