C20H34N4O3S — CID 140731592
2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-propan-2-yl-1,3,4-oxadiazolidin-2-yl)thiolane-3-carboxamide (PubChem CID 140731592) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-propan-2-yl-1,3,4-oxadiazolidin-2-yl)thiolane-3-carboxamide.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-propan-2-yl-1,3,4-oxadiazolidin-2-yl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 140731592 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-propan-2-yl-1,3,4-oxadiazolidin-2-yl)thiolane-3-carboxamide |
| SMILES | CC(C)C1NNC(NC(=O)C2CCSC2NC(=O)C2CC3CCCCC3C2)O1 |
| InChI | InChI=1S/C20H34N4O3S/c1-11(2)18-23-24-20(27-18)22-17(26)15-7-8-28-19(15)21-16(25)14-9-12-5-3-4-6-13(12)10-14/h11-15,18-20,23-24H,3-10H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | WHUKBKVXAKTKOE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |