C18H30N4O2S2 — CID 140731714
2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-methyl-1,3,4-thiadiazolidin-2-yl)thiolane-3-carboxamide (PubChem CID 140731714) has the molecular formula C18H30N4O2S2 and a molecular weight of 398.60 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-methyl-1,3,4-thiadiazolidin-2-yl)thiolane-3-carboxamide.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-methyl-1,3,4-thiadiazolidin-2-yl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 140731714 |
| Molecular Formula | C18H30N4O2S2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonylamino)-N-(5-methyl-1,3,4-thiadiazolidin-2-yl)thiolane-3-carboxamide |
| SMILES | CC1NNC(NC(=O)C2CCSC2NC(=O)C2CC3CCCCC3C2)S1 |
| InChI | InChI=1S/C18H30N4O2S2/c1-10-21-22-18(26-10)20-16(24)14-6-7-25-17(14)19-15(23)13-8-11-4-2-3-5-12(11)9-13/h10-14,17-18,21-22H,2-9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | MSFBOABKZQQLJD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |