C22H28BNO4 — CID 140732166
1-[(E)-2-phenylethenyl]-5-[(2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (PubChem CID 140732166) has the molecular formula C22H28BNO4 and a molecular weight of 381.28 g/mol. Its IUPAC name is 1-[(E)-2-phenylethenyl]-5-[(2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione.
| Compound Name | 1-[(E)-2-phenylethenyl]-5-[(2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
|---|---|
| PubChem CID | 140732166 |
| Molecular Formula | C22H28BNO4 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[(E)-2-phenylethenyl]-5-[(2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| SMILES | C[C@@H]1C2C[C@@H](C[C@H]1[N+]13CC(=O)O[B-]1(/C=C/c1ccccc1)OC(=O)C3)C2(C)C |
| InChI | InChI=1S/C22H28BNO4/c1-15-18-11-17(22(18,2)3)12-19(15)24-13-20(25)27-23(24,28-21(26)14-24)10-9-16-7-5-4-6-8-16/h4-10,15,17-19H,11-14H2,1-3H3/b10-9+/t15-,17+,18?,19-,23?,24?/m1/s1 |
| InChIKey | CRFOTONKLPCDDM-OUIQRWPPSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|