C14H18N2O3 — CID 140732662
4-isocyano-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 140732662) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-isocyano-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 4-isocyano-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 140732662 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-isocyano-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)N(CCOC)CCOC)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-15-13-6-4-12(5-7-13)14(17)16(8-10-18-2)9-11-19-3/h4-7H,8-11H2,2-3H3 |
| InChIKey | SCQKSVSYVKUQHQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|