C13H17N3Si — CID 140733233
5,6-dihydroimidazo[2,1-a][2,6]naphthyridin-3-yl(trimethyl)silane (PubChem CID 140733233) has the molecular formula C13H17N3Si and a molecular weight of 243.39 g/mol. Its IUPAC name is 5,6-dihydroimidazo[2,1-a][2,6]naphthyridin-3-yl(trimethyl)silane.
| Compound Name | 5,6-dihydroimidazo[2,1-a][2,6]naphthyridin-3-yl(trimethyl)silane |
|---|---|
| PubChem CID | 140733233 |
| Molecular Formula | C13H17N3Si |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 5,6-dihydroimidazo[2,1-a][2,6]naphthyridin-3-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)c1cnc2n1CCc1cnccc1-2 |
| InChI | InChI=1S/C13H17N3Si/c1-17(2,3)12-9-15-13-11-4-6-14-8-10(11)5-7-16(12)13/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | YDASPZRIKQUXQS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|