C23H32N2O4 — CID 140733600
5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 140733600) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 140733600 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1CCCC(N2C(=O)C3CCC(C4CCC5C(=O)NC(=O)C5C4)CC3C2=O)C1 |
| InChI | InChI=1S/C23H32N2O4/c1-12-3-2-4-15(9-12)25-22(28)17-8-6-14(11-19(17)23(25)29)13-5-7-16-18(10-13)21(27)24-20(16)26/h12-19H,2-11H2,1H3,(H,24,26,27) |
| InChIKey | SBZATMMZMIDQCV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|