C24H32N2O5 — CID 140733601
5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindole-5-carbonyl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 140733601) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindole-5-carbonyl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindole-5-carbonyl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 140733601 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindole-5-carbonyl)-2-(3-methylcyclohexyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1CCCC(N2C(=O)C3CCC(C(=O)C4CCC5C(=O)NC(=O)C5C4)CC3C2=O)C1 |
| InChI | InChI=1S/C24H32N2O5/c1-12-3-2-4-15(9-12)26-23(30)17-8-6-14(11-19(17)24(26)31)20(27)13-5-7-16-18(10-13)22(29)25-21(16)28/h12-19H,2-11H2,1H3,(H,25,28,29) |
| InChIKey | JVZLHJYYOQSQJA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|