C26H44O3Si — CID 140733786
(1S,4S,5S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one (PubChem CID 140733786) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is (1S,4S,5S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one.
| Compound Name | (1S,4S,5S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one |
|---|---|
| PubChem CID | 140733786 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (1S,4S,5S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@@H]2[C@@H]1O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C26H44O3Si/c1-14-11-18-21(27)15(2)13-26(18)16(3)12-17-20(25(17,7)8)19(23(26)28)22(14)29-30(9,10)24(4,5)6/h13-14,16-22,27H,11-12H2,1-10H3/t14-,16-,17-,18-,19-,20-,21-,22-,26-/m1/s1 |
| InChIKey | JMGNCAKGRXCRQM-UVMFNQEKSA-N |
| XLogP | 5.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|