About CID 140734373
CID 140734373 (PubChem CID 140734373) has the molecular formula C38H50N3O6Si
and a molecular weight of 672.92 g/mol.
Molecular Properties
| Compound Name | CID 140734373 |
| PubChem CID | 140734373 |
| Molecular Formula | C38H50N3O6Si |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | — |
| SMILES | COC(=O)c1cncc(CN(C)C(=O)c2ccc(C[C@@H]3CC[C@H]([C@H](O[Si](C)C(C)(C)C)c4ccccc4)N3C(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C38H50N3O6Si/c1-37(2,3)46-36(44)41-31(19-20-32(41)33(28-13-11-10-12-14-28)47-48(9)38(4,5)6)22-26-15-17-29(18-16-26)34(42)40(7)25-27-21-30(24-39-23-27)35(43)45-8/h10-18,21,23-24,31-33H,19-20,22,25H2,1-9H3/t31-,32+,33+/m0/s1 |
| InChIKey | XIHRJDILNMFQEU-WIHCDAFUSA-N |
| XLogP | 7.63 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140734373 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140734373?
The IUPAC name of CID 140734373 (CID 140734373) is not available.
What is the SMILES notation for CID 140734373?
The canonical SMILES for CID 140734373 is COC(=O)c1cncc(CN(C)C(=O)c2ccc(C[C@@H]3CC[C@H]([C@H](O[Si](C)C(C)(C)C)c4ccccc4)N3C(=O)OC(C)(C)C)cc2)c1.
What is the InChIKey of CID 140734373?
The InChIKey is XIHRJDILNMFQEU-WIHCDAFUSA-N. The full InChI is InChI=1S/C38H50N3O6Si/c1-37(2,3)46-36(44)41-31(19-20-32(41)33(28-13-11-10-12-14-28)47-48(9)38(4,5)6)22-26-15-17-29(18-16-26)34(42)40(7)25-27-21-30(24-39-23-27)35(43)45-8/h10-18,21,23-24,31-33H,19-20,22,25H2,1-9H3/t31-,32+,33+/m0/s1.
What are the key properties of CID 140734373?
CID 140734373 has a molecular weight of 672.92 g/mol, XLogP of 7.63, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140734373 is sourced from PubChem (CID 140734373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).