C16H31BO2 — CID 140735208
2-[(E)-dec-5-en-5-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140735208) has the molecular formula C16H31BO2 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-[(E)-dec-5-en-5-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-dec-5-en-5-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140735208 |
| Molecular Formula | C16H31BO2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-[(E)-dec-5-en-5-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCC/C=C(/CCCC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H31BO2/c1-7-9-11-13-14(12-10-8-2)17-18-15(3,4)16(5,6)19-17/h13H,7-12H2,1-6H3/b14-13- |
| InChIKey | PIHDLJDXUHHYDJ-YPKPFQOOSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|