C5H10N4 — CID 140735383
1,2,3,4-tetrahydropyrimidine-5-carboximidamide (PubChem CID 140735383) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrimidine-5-carboximidamide.
| Compound Name | 1,2,3,4-tetrahydropyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 140735383 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 1,2,3,4-tetrahydropyrimidine-5-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CNCNC1 |
| InChI | InChI=1S/C5H10N4/c6-5(7)4-1-8-3-9-2-4/h1,8-9H,2-3H2,(H3,6,7) |
| InChIKey | BKARLFGDQNNESK-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|