C12H14BNO5 — CID 140735629
11,11-dimethyl-3-(nitromethyl)-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-triene (PubChem CID 140735629) has the molecular formula C12H14BNO5 and a molecular weight of 263.06 g/mol. Its IUPAC name is 11,11-dimethyl-3-(nitromethyl)-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-triene.
| Compound Name | 11,11-dimethyl-3-(nitromethyl)-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-triene |
|---|---|
| PubChem CID | 140735629 |
| Molecular Formula | C12H14BNO5 |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 11,11-dimethyl-3-(nitromethyl)-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-triene |
| SMILES | CC1(C)COc2cccc3c2B(OC3C[N+](=O)[O-])O1 |
| InChI | InChI=1S/C12H14BNO5/c1-12(2)7-17-9-5-3-4-8-10(6-14(15)16)18-13(19-12)11(8)9/h3-5,10H,6-7H2,1-2H3 |
| InChIKey | JVBRXNPJABQPCK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|