C14H18N4O — CID 140735901
6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline-3-carbohydrazide (PubChem CID 140735901) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline-3-carbohydrazide.
| Compound Name | 6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline-3-carbohydrazide |
|---|---|
| PubChem CID | 140735901 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline-3-carbohydrazide |
| SMILES | NNC(=O)c1ccc2c(c1)N=C1CCCCCN1C2 |
| InChI | InChI=1S/C14H18N4O/c15-17-14(19)10-5-6-11-9-18-7-3-1-2-4-13(18)16-12(11)8-10/h5-6,8H,1-4,7,9,15H2,(H,17,19) |
| InChIKey | ZSQPODKKBRVREF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|