C30H24F5N3O4 — CID 140736362
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 140736362) has the molecular formula C30H24F5N3O4 and a molecular weight of 585.53 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 140736362 |
| Molecular Formula | C30H24F5N3O4 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)cccc4F)nc(Cc4ccc(C(O)C(F)(F)F)cc4)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C30H24F5N3O4/c1-41-19-11-10-18(24(13-19)42-2)14-38-15-23-26(29(38)40)22(36-28(37-23)25-20(31)4-3-5-21(25)32)12-16-6-8-17(9-7-16)27(39)30(33,34)35/h3-11,13,27,39H,12,14-15H2,1-2H3 |
| InChIKey | QCXYLNQSLMXWJG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |