C47H94O3Si2 — CID 140736953
(7R,9Z,26Z,29R)-7,29-bis[[tert-butyl(dimethyl)silyl]oxy]pentatriaconta-9,26-dien-18-one (PubChem CID 140736953) has the molecular formula C47H94O3Si2 and a molecular weight of 763.44 g/mol. Its IUPAC name is (7R,9Z,26Z,29R)-7,29-bis[[tert-butyl(dimethyl)silyl]oxy]pentatriaconta-9,26-dien-18-one.
| Compound Name | (7R,9Z,26Z,29R)-7,29-bis[[tert-butyl(dimethyl)silyl]oxy]pentatriaconta-9,26-dien-18-one |
|---|---|
| PubChem CID | 140736953 |
| Molecular Formula | C47H94O3Si2 |
| Molecular Weight | 763.44 g/mol |
| Exact Mass | 762.67 |
| IUPAC Name | (7R,9Z,26Z,29R)-7,29-bis[[tert-butyl(dimethyl)silyl]oxy]pentatriaconta-9,26-dien-18-one |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)CCCCCCC/C=C\C[C@@H](CCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C47H94O3Si2/c1-13-15-17-33-39-44(49-51(9,10)46(3,4)5)41-35-29-25-21-19-23-27-31-37-43(48)38-32-28-24-20-22-26-30-36-42-45(40-34-18-16-14-2)50-52(11,12)47(6,7)8/h29-30,35-36,44-45H,13-28,31-34,37-42H2,1-12H3/b35-29-,36-30-/t44-,45-/m1/s1 |
| InChIKey | BOMOBMDNGKBNAX-QTPYYCMQSA-N |
| XLogP | 16.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.44 |
| LogP ≤ 5 | 16.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|