C23H19BrN2OS — CID 140737466
(2E)-2-[(2Z)-2-[(5-bromo-4-hexylthiophen-2-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 140737466) has the molecular formula C23H19BrN2OS and a molecular weight of 451.39 g/mol. Its IUPAC name is (2E)-2-[(2Z)-2-[(5-bromo-4-hexylthiophen-2-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(2Z)-2-[(5-bromo-4-hexylthiophen-2-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 140737466 |
| Molecular Formula | C23H19BrN2OS |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | (2E)-2-[(2Z)-2-[(5-bromo-4-hexylthiophen-2-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C/c2cc(CCCCCC)c(Br)s2)/C(=O)c2ccccc2/1 |
| InChI | InChI=1S/C23H19BrN2OS/c1-3-4-5-6-9-15-12-16(28-23(15)24)13-19-21(20(14-25)26-2)17-10-7-8-11-18(17)22(19)27/h7-8,10-13H,3-6,9H2,1H3/b19-13-,21-20+ |
| InChIKey | HZKLIKUVTLCEGC-PIYCVYLUSA-N |
| XLogP | 7.07 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|