C21H21ClF2IN3O3S — CID 140738792
N-[(6-chloro-2-cyclopropyl-3-iodo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidine-2-carboxamide (PubChem CID 140738792) has the molecular formula C21H21ClF2IN3O3S and a molecular weight of 595.84 g/mol. Its IUPAC name is N-[(6-chloro-2-cyclopropyl-3-iodo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidine-2-carboxamide.
| Compound Name | N-[(6-chloro-2-cyclopropyl-3-iodo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140738792 |
| Molecular Formula | C21H21ClF2IN3O3S |
| Molecular Weight | 595.84 g/mol |
| Exact Mass | 595.00 |
| IUPAC Name | N-[(6-chloro-2-cyclopropyl-3-iodo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidine-2-carboxamide |
| SMILES | CC1C(F)CC(C(=O)NCc2cc(Cl)nc(C3CC3)c2I)N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21ClF2IN3O3S/c1-11-16(24)9-17(28(11)32(30,31)15-6-4-14(23)5-7-15)21(29)26-10-13-8-18(22)27-20(19(13)25)12-2-3-12/h4-8,11-12,16-17H,2-3,9-10H2,1H3,(H,26,29) |
| InChIKey | HTEVVSIIAXZTGK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|