About 8-propan-2-yl-1,9-dihydropyrene
8-propan-2-yl-1,9-dihydropyrene (PubChem CID 140739340) has the molecular formula C19H18
and a molecular weight of 246.35 g/mol. Its IUPAC name is 8-propan-2-yl-1,9-dihydropyrene.
Molecular Properties
| Compound Name | 8-propan-2-yl-1,9-dihydropyrene |
| PubChem CID | 140739340 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 8-propan-2-yl-1,9-dihydropyrene |
| SMILES | CC(C)c1ccc2ccc3c4c2c1CC=C4CC=C3 |
| InChI | InChI=1S/C19H18/c1-12(2)16-10-8-15-7-6-13-4-3-5-14-9-11-17(16)19(15)18(13)14/h3-4,6-10,12H,5,11H2,1-2H3 |
| InChIKey | GEKQMRZBFMTYLE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 8-propan-2-yl-1,9-dihydropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propan-2-yl-1,9-dihydropyrene?
The IUPAC name of 8-propan-2-yl-1,9-dihydropyrene (CID 140739340) is 8-propan-2-yl-1,9-dihydropyrene.
What is the SMILES notation for 8-propan-2-yl-1,9-dihydropyrene?
The canonical SMILES for 8-propan-2-yl-1,9-dihydropyrene is CC(C)c1ccc2ccc3c4c2c1CC=C4CC=C3.
What is the InChIKey of 8-propan-2-yl-1,9-dihydropyrene?
The InChIKey is GEKQMRZBFMTYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18/c1-12(2)16-10-8-15-7-6-13-4-3-5-14-9-11-17(16)19(15)18(13)14/h3-4,6-10,12H,5,11H2,1-2H3.
What are the key properties of 8-propan-2-yl-1,9-dihydropyrene?
8-propan-2-yl-1,9-dihydropyrene has a molecular weight of 246.35 g/mol, XLogP of 5.32, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propan-2-yl-1,9-dihydropyrene is sourced from PubChem (CID 140739340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).