C22H18N5O3+ — CID 140739359
(8R)-8-[(S)-(3,4-diethynyl-4H-pyrazol-1-ium-1-yl)-phenylmethyl]-4-hydroxy-6-methyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione (PubChem CID 140739359) has the molecular formula C22H18N5O3+ and a molecular weight of 400.42 g/mol. Its IUPAC name is (8R)-8-[(S)-(3,4-diethynyl-4H-pyrazol-1-ium-1-yl)-phenylmethyl]-4-hydroxy-6-methyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione.
| Compound Name | (8R)-8-[(S)-(3,4-diethynyl-4H-pyrazol-1-ium-1-yl)-phenylmethyl]-4-hydroxy-6-methyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
|---|---|
| PubChem CID | 140739359 |
| Molecular Formula | C22H18N5O3+ |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (8R)-8-[(S)-(3,4-diethynyl-4H-pyrazol-1-ium-1-yl)-phenylmethyl]-4-hydroxy-6-methyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
| SMILES | C#CC1=N[N+]([C@@H](c2ccccc2)[C@H]2CN(C)C(=O)c3c(O)c(=O)cnn32)=CC1C#C |
| InChI | InChI=1S/C22H17N5O3/c1-4-14-12-26(24-16(14)5-2)19(15-9-7-6-8-10-15)17-13-25(3)22(30)20-21(29)18(28)11-23-27(17)20/h1-2,6-12,14,17,19H,13H2,3H3/p+1/t14?,17-,19+/m1/s1 |
| InChIKey | GLPXMZKZMBHWMW-VNTLTUIWSA-O |
| XLogP | 0.65 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|