C13H17BN2O7S — CID 140739659
(3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 140739659) has the molecular formula C13H17BN2O7S and a molecular weight of 356.17 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 140739659 |
| Molecular Formula | C13H17BN2O7S |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CS(=O)(=O)NCCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C13H17BN2O7S/c1-24(21,22)15-6-5-11(17)16-10-7-8-3-2-4-9(13(18)19)12(8)23-14(10)20/h2-4,10,15,20H,5-7H2,1H3,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | MWQLMQWTGVUGSR-JTQLQIEISA-N |
| XLogP | -1.24 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|