C13H15BN2O6 — CID 140739679
(3R)-3-[(4-amino-4-oxobutanoyl)amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 140739679) has the molecular formula C13H15BN2O6 and a molecular weight of 306.08 g/mol. Its IUPAC name is (3R)-3-[(4-amino-4-oxobutanoyl)amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(4-amino-4-oxobutanoyl)amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 140739679 |
| Molecular Formula | C13H15BN2O6 |
| Molecular Weight | 306.08 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3R)-3-[(4-amino-4-oxobutanoyl)amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NC(=O)CCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C13H15BN2O6/c15-10(17)4-5-11(18)16-9-6-7-2-1-3-8(13(19)20)12(7)22-14(9)21/h1-3,9,21H,4-6H2,(H2,15,17)(H,16,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | JDSUIPONCKFTKK-VIFPVBQESA-N |
| XLogP | -0.91 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.08 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|