C8H5Cl3O — CID 14074061
2-chloro-4-(2,2-dichloroethenyl)phenol (PubChem CID 14074061) has the molecular formula C8H5Cl3O and a molecular weight of 223.49 g/mol. Its IUPAC name is 2-chloro-4-(2,2-dichloroethenyl)phenol.
| Compound Name | 2-chloro-4-(2,2-dichloroethenyl)phenol |
|---|---|
| PubChem CID | 14074061 |
| Molecular Formula | C8H5Cl3O |
| Molecular Weight | 223.49 g/mol |
| Exact Mass | 221.94 |
| IUPAC Name | 2-chloro-4-(2,2-dichloroethenyl)phenol |
| SMILES | Oc1ccc(C=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl3O/c9-6-3-5(4-8(10)11)1-2-7(6)12/h1-4,12H |
| InChIKey | VMVNHIYTBYPWPH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |