C23H18ClN7O2 — CID 140740886
N-[2-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide (PubChem CID 140740886) has the molecular formula C23H18ClN7O2 and a molecular weight of 459.90 g/mol. Its IUPAC name is N-[2-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide.
| Compound Name | N-[2-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 140740886 |
| Molecular Formula | C23H18ClN7O2 |
| Molecular Weight | 459.90 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-[2-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide |
| SMILES | [C-]#[N+]C(=C)C(=O)N(CCn1nc(-c2ccc(Cl)c(O)c2)c2c(N)ncnc21)c1ccccc1 |
| InChI | InChI=1S/C23H18ClN7O2/c1-14(26-2)23(33)30(16-6-4-3-5-7-16)10-11-31-22-19(21(25)27-13-28-22)20(29-31)15-8-9-17(24)18(32)12-15/h3-9,12-13,32H,1,10-11H2,(H2,25,27,28) |
| InChIKey | ISHDQDYZJVGJTB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.90 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|