C34H32BrF3N4O6 — CID 140741137
2-[(3S)-5-[(6-bromo-2-methoxynaphthalen-1-yl)methyl]-4-oxo-1-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)benzoyl]-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide (PubChem CID 140741137) has the molecular formula C34H32BrF3N4O6 and a molecular weight of 729.55 g/mol. Its IUPAC name is 2-[(3S)-5-[(6-bromo-2-methoxynaphthalen-1-yl)methyl]-4-oxo-1-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)benzoyl]-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide.
| Compound Name | 2-[(3S)-5-[(6-bromo-2-methoxynaphthalen-1-yl)methyl]-4-oxo-1-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)benzoyl]-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 140741137 |
| Molecular Formula | C34H32BrF3N4O6 |
| Molecular Weight | 729.55 g/mol |
| Exact Mass | 728.15 |
| IUPAC Name | 2-[(3S)-5-[(6-bromo-2-methoxynaphthalen-1-yl)methyl]-4-oxo-1-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)benzoyl]-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide |
| SMILES | CNC(C)(C(N)=O)[C@@H]1CN(C(=O)c2ccc(C(O)(O)C(F)(F)F)cc2)c2ccccc2N(Cc2c(OC)ccc3cc(Br)ccc23)C1=O |
| InChI | InChI=1S/C34H32BrF3N4O6/c1-32(40-2,31(39)45)25-18-42(29(43)19-8-11-21(12-9-19)33(46,47)34(36,37)38)27-7-5-4-6-26(27)41(30(25)44)17-24-23-14-13-22(35)16-20(23)10-15-28(24)48-3/h4-16,25,40,46-47H,17-18H2,1-3H3,(H2,39,45)/t25-,32?/m1/s1 |
| InChIKey | ZTZXMQJJMKERRQ-LYYPKXFYSA-N |
| XLogP | 4.58 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|