C31H28F5N3O — CID 140741652
[4'-[2-(dimethylamino)-3-fluorophenyl]spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,1'-cyclohexane]-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 140741652) has the molecular formula C31H28F5N3O and a molecular weight of 553.58 g/mol. Its IUPAC name is [4'-[2-(dimethylamino)-3-fluorophenyl]spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,1'-cyclohexane]-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | [4'-[2-(dimethylamino)-3-fluorophenyl]spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,1'-cyclohexane]-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 140741652 |
| Molecular Formula | C31H28F5N3O |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | [4'-[2-(dimethylamino)-3-fluorophenyl]spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,1'-cyclohexane]-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | CN(C)c1c(F)cccc1C1CCC2(CC1)c1[nH]c3ccccc3c1CCN2C(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C31H28F5N3O/c1-38(2)28-18(7-5-8-22(28)32)17-10-13-31(14-11-17)29-20(19-6-3-4-9-24(19)37-29)12-15-39(31)30(40)21-16-23(33)26(35)27(36)25(21)34/h3-9,16-17,37H,10-15H2,1-2H3 |
| InChIKey | TXXQDOLQNQMQRE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|