C17H26BNO2 — CID 140741790
2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (PubChem CID 140741790) has the molecular formula C17H26BNO2 and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine.
| Compound Name | 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 140741790 |
| Molecular Formula | C17H26BNO2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| SMILES | CC1(C)OB(c2ccc(CC3CCCN3)cc2)OC1(C)C |
| InChI | InChI=1S/C17H26BNO2/c1-16(2)17(3,4)21-18(20-16)14-9-7-13(8-10-14)12-15-6-5-11-19-15/h7-10,15,19H,5-6,11-12H2,1-4H3 |
| InChIKey | JZCZKIQFGSECQM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|