C20H28N10O10P2S2 — CID 140744134
8,17-bis(6-amino-4,5-dihydropurin-9-yl)-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-9,18-diol (PubChem CID 140744134) has the molecular formula C20H28N10O10P2S2 and a molecular weight of 694.59 g/mol. Its IUPAC name is 8,17-bis(6-amino-4,5-dihydropurin-9-yl)-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-9,18-diol.
| Compound Name | 8,17-bis(6-amino-4,5-dihydropurin-9-yl)-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-9,18-diol |
|---|---|
| PubChem CID | 140744134 |
| Molecular Formula | C20H28N10O10P2S2 |
| Molecular Weight | 694.59 g/mol |
| Exact Mass | 694.09 |
| IUPAC Name | 8,17-bis(6-amino-4,5-dihydropurin-9-yl)-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-9,18-diol |
| SMILES | NC1=NC=NC2C1N=CN2C1OC2COP(O)(=S)OC3C(O)C(COP(O)(=S)OC2C1O)OC3N1C=NC2C(N)=NC=NC21 |
| InChI | InChI=1S/C20H28N10O10P2S2/c21-15-9-17(25-3-23-15)29(5-27-9)19-12(32)13-8(38-19)2-36-42(34,44)40-14-11(31)7(1-35-41(33,43)39-13)37-20(14)30-6-28-10-16(22)24-4-26-18(10)30/h3-14,17-20,31-32H,1-2H2,(H,33,43)(H,34,44)(H2,21,23,25)(H2,22,24,26) |
| InChIKey | TVRIZZKRSXJDNY-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 268.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.59 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|