C54H36F4N4O3 — CID 140745893
4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-6-isocyano-2-benzofuran-5-carbonitrile (PubChem CID 140745893) has the molecular formula C54H36F4N4O3 and a molecular weight of 864.90 g/mol. Its IUPAC name is 4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-6-isocyano-2-benzofuran-5-carbonitrile.
| Compound Name | 4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-6-isocyano-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 140745893 |
| Molecular Formula | C54H36F4N4O3 |
| Molecular Weight | 864.90 g/mol |
| Exact Mass | 864.27 |
| IUPAC Name | 4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-6-isocyano-2-benzofuran-5-carbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(-n2c3ccc(C(C)(C)C)cc3c3cc4c(cc32)oc2ccccc24)c2c(c1-n1c3ccc(C(C)(C)C)cc3c3cc4c(cc31)oc1ccccc14)C(F)(F)OC2(F)F |
| InChI | InChI=1S/C54H36F4N4O3/c1-51(2,3)27-16-18-38-31(20-27)33-22-35-29-12-8-10-14-42(29)63-44(35)24-40(33)61(38)49-37(26-59)48(60-7)50(47-46(49)53(55,56)65-54(47,57)58)62-39-19-17-28(52(4,5)6)21-32(39)34-23-36-30-13-9-11-15-43(30)64-45(36)25-41(34)62/h8-25H,1-6H3 |
| InChIKey | KZGBXRSYBVGECO-UHFFFAOYSA-N |
| XLogP | 15.83 |
| TPSA | 73.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.90 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|