C29H31ClFN7O3 — CID 140746216
1-[4-[7-[(1S)-2-[(3S,5S)-3-chloro-5-fluoromorpholin-4-yl]-1-(5-methyl-1H-indazol-4-yl)ethoxy]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 140746216) has the molecular formula C29H31ClFN7O3 and a molecular weight of 580.06 g/mol. Its IUPAC name is 1-[4-[7-[(1S)-2-[(3S,5S)-3-chloro-5-fluoromorpholin-4-yl]-1-(5-methyl-1H-indazol-4-yl)ethoxy]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-[(1S)-2-[(3S,5S)-3-chloro-5-fluoromorpholin-4-yl]-1-(5-methyl-1H-indazol-4-yl)ethoxy]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 140746216 |
| Molecular Formula | C29H31ClFN7O3 |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 1-[4-[7-[(1S)-2-[(3S,5S)-3-chloro-5-fluoromorpholin-4-yl]-1-(5-methyl-1H-indazol-4-yl)ethoxy]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3cc(O[C@H](CN4[C@@H](F)COC[C@@H]4Cl)c4c(C)ccc5[nH]ncc45)ccc23)CC1 |
| InChI | InChI=1S/C29H31ClFN7O3/c1-3-27(39)36-8-10-37(11-9-36)29-20-6-5-19(12-23(20)32-17-33-29)41-24(14-38-25(30)15-40-16-26(38)31)28-18(2)4-7-22-21(28)13-34-35-22/h3-7,12-13,17,24-26H,1,8-11,14-16H2,2H3,(H,34,35)/t24-,25-,26-/m1/s1 |
| InChIKey | AUUAGWVICFAKTR-TWJOJJKGSA-N |
| XLogP | 3.96 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|