C22H36BaN2O18 — CID 14074707
bis((4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate);barium(2+) (PubChem CID 14074707) has the molecular formula C22H36BaN2O18 and a molecular weight of 753.85 g/mol. Its IUPAC name is bis((4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate);barium(2+).
| Compound Name | bis((4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate);barium(2+) |
|---|---|
| PubChem CID | 14074707 |
| Molecular Formula | C22H36BaN2O18 |
| Molecular Weight | 753.85 g/mol |
| Exact Mass | 754.10 |
| IUPAC Name | bis((4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate);barium(2+) |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(O)(C(=O)[O-])C[C@@H]1O.CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(O)(C(=O)[O-])C[C@@H]1O.[Ba+2] |
| InChI | InChI=1S/2C11H19NO9.Ba/c2*1-4(14)12-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-13;/h2*5-9,13,15-17,20H,2-3H2,1H3,(H,12,14)(H,18,19);/q;;+2/p-2/t2*5-,6+,7+,8+,9+,11?;/m00./s1 |
| InChIKey | USMLMBIZRQKGOU-TVNAWNCPSA-L |
| XLogP | -10.79 |
| TPSA | 359.22 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.85 |
| LogP ≤ 5 | -10.79 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 18 |