About butanoyl 2-oxodecaneperoxoate
butanoyl 2-oxodecaneperoxoate (PubChem CID 140747300) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is butanoyl 2-oxodecaneperoxoate.
Molecular Properties
| Compound Name | butanoyl 2-oxodecaneperoxoate |
| PubChem CID | 140747300 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | butanoyl 2-oxodecaneperoxoate |
| SMILES | CCCCCCCCC(=O)C(=O)OOC(=O)CCC |
| InChI | InChI=1S/C14H24O5/c1-3-5-6-7-8-9-11-12(15)14(17)19-18-13(16)10-4-2/h3-11H2,1-2H3 |
| InChIKey | DWTOABZSDIWSPS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butanoyl 2-oxodecaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyl 2-oxodecaneperoxoate?
The IUPAC name of butanoyl 2-oxodecaneperoxoate (CID 140747300) is butanoyl 2-oxodecaneperoxoate.
What is the SMILES notation for butanoyl 2-oxodecaneperoxoate?
The canonical SMILES for butanoyl 2-oxodecaneperoxoate is CCCCCCCCC(=O)C(=O)OOC(=O)CCC.
What is the InChIKey of butanoyl 2-oxodecaneperoxoate?
The InChIKey is DWTOABZSDIWSPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5/c1-3-5-6-7-8-9-11-12(15)14(17)19-18-13(16)10-4-2/h3-11H2,1-2H3.
What are the key properties of butanoyl 2-oxodecaneperoxoate?
butanoyl 2-oxodecaneperoxoate has a molecular weight of 272.34 g/mol, XLogP of 3.11, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyl 2-oxodecaneperoxoate is sourced from PubChem (CID 140747300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).