C61H37N6O+ — CID 140747607
2-[6-(2,4-diphenyl-1,3,5-triazin-1-ium-1-yl)spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran]-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 140747607) has the molecular formula C61H37N6O+ and a molecular weight of 870.01 g/mol. Its IUPAC name is 2-[6-(2,4-diphenyl-1,3,5-triazin-1-ium-1-yl)spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran]-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-(2,4-diphenyl-1,3,5-triazin-1-ium-1-yl)spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran]-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 140747607 |
| Molecular Formula | C61H37N6O+ |
| Molecular Weight | 870.01 g/mol |
| Exact Mass | 869.30 |
| IUPAC Name | 2-[6-(2,4-diphenyl-1,3,5-triazin-1-ium-1-yl)spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran]-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccc(-[n+]6cnc(-c7ccccc7)nc6-c6ccccc6)cc5-4)c4ccccc4-c4c3ccc3c4oc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C61H37N6O/c1-5-17-38(18-6-1)56-62-37-67(60(66-56)41-23-11-4-12-24-41)43-30-33-50-48(36-43)44-31-29-42(59-64-57(39-19-7-2-8-20-39)63-58(65-59)40-21-9-3-10-22-40)35-52(44)61(50)49-27-15-13-26-47(49)54-51(61)34-32-46-45-25-14-16-28-53(45)68-55(46)54/h1-37H/q+1 |
| InChIKey | SUJSHODVXQICMC-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 81.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.01 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|