C22H39BO2 — CID 140748247
4,4,5,5-tetramethyl-2-[4-[4-(2-methylpropyl)cyclohexyl]cyclohexen-1-yl]-1,3,2-dioxaborolane (PubChem CID 140748247) has the molecular formula C22H39BO2 and a molecular weight of 346.36 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[4-(2-methylpropyl)cyclohexyl]cyclohexen-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[4-(2-methylpropyl)cyclohexyl]cyclohexen-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140748247 |
| Molecular Formula | C22H39BO2 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[4-(2-methylpropyl)cyclohexyl]cyclohexen-1-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)CC1CCC(C2CC=C(B3OC(C)(C)C(C)(C)O3)CC2)CC1 |
| InChI | InChI=1S/C22H39BO2/c1-16(2)15-17-7-9-18(10-8-17)19-11-13-20(14-12-19)23-24-21(3,4)22(5,6)25-23/h13,16-19H,7-12,14-15H2,1-6H3 |
| InChIKey | QMJJIAPCIMAILH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|